C18H19NO — CID 10989171
(3R,4S)-4-(N-phenylanilino)hexa-1,5-dien-3-ol (PubChem CID 10989171) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is (3R,4S)-4-(N-phenylanilino)hexa-1,5-dien-3-ol.
| Compound Name | (3R,4S)-4-(N-phenylanilino)hexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 10989171 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (3R,4S)-4-(N-phenylanilino)hexa-1,5-dien-3-ol |
| SMILES | C=C[C@@H](O)[C@H](C=C)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO/c1-3-17(18(20)4-2)19(15-11-7-5-8-12-15)16-13-9-6-10-14-16/h3-14,17-18,20H,1-2H2/t17-,18+/m0/s1 |
| InChIKey | WBMCJKXPHRCNLN-ZWKOTPCHSA-N |
| XLogP | 3.93 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|