C16H16O — CID 88826241
1,1-diphenylbut-3-en-2-ol (PubChem CID 88826241) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is 1,1-diphenylbut-3-en-2-ol.
| Compound Name | 1,1-diphenylbut-3-en-2-ol |
|---|---|
| PubChem CID | 88826241 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1,1-diphenylbut-3-en-2-ol |
| SMILES | C=CC(O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O/c1-2-15(17)16(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h2-12,15-17H,1H2 |
| InChIKey | PNODJDSFALPKGO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|