C17H15FO — CID 90206715
5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol (PubChem CID 90206715) has the molecular formula C17H15FO and a molecular weight of 254.30 g/mol. Its IUPAC name is 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol.
| Compound Name | 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol |
|---|---|
| PubChem CID | 90206715 |
| Molecular Formula | C17H15FO |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol |
| SMILES | OC(C=C=CF)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H15FO/c18-13-7-12-16(19)17(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-13,16-17,19H |
| InChIKey | LAXFCDVIQSZFBF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |