About 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol
5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol (PubChem CID 90206715) has the molecular formula C17H15FO
and a molecular weight of 254.30 g/mol. Its IUPAC name is 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol.
Molecular Properties
| Compound Name | 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol |
| PubChem CID | 90206715 |
| Molecular Formula | C17H15FO |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol |
| SMILES | OC(C=C=CF)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H15FO/c18-13-7-12-16(19)17(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-13,16-17,19H |
| InChIKey | LAXFCDVIQSZFBF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol?
The IUPAC name of 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol (CID 90206715) is 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol.
What is the SMILES notation for 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol?
The canonical SMILES for 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol is OC(C=C=CF)C(c1ccccc1)c1ccccc1.
What is the InChIKey of 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol?
The InChIKey is LAXFCDVIQSZFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FO/c18-13-7-12-16(19)17(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-13,16-17,19H.
What are the key properties of 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol?
5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol has a molecular weight of 254.30 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,1-diphenylpenta-3,4-dien-2-ol is sourced from PubChem (CID 90206715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).