C22H23N5O3 — CID 70574818
1-(N-[4-[N-(1-hydroxyprop-2-enyl)anilino]-6-methoxy-1,3,5-triazin-2-yl]anilino)prop-2-en-1-ol (PubChem CID 70574818) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 1-(N-[4-[N-(1-hydroxyprop-2-enyl)anilino]-6-methoxy-1,3,5-triazin-2-yl]anilino)prop-2-en-1-ol.
| Compound Name | 1-(N-[4-[N-(1-hydroxyprop-2-enyl)anilino]-6-methoxy-1,3,5-triazin-2-yl]anilino)prop-2-en-1-ol |
|---|---|
| PubChem CID | 70574818 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 1-(N-[4-[N-(1-hydroxyprop-2-enyl)anilino]-6-methoxy-1,3,5-triazin-2-yl]anilino)prop-2-en-1-ol |
| SMILES | C=CC(O)N(c1ccccc1)c1nc(OC)nc(N(c2ccccc2)C(O)C=C)n1 |
| InChI | InChI=1S/C22H23N5O3/c1-4-18(28)26(16-12-8-6-9-13-16)20-23-21(25-22(24-20)30-3)27(19(29)5-2)17-14-10-7-11-15-17/h4-15,18-19,28-29H,1-2H2,3H3 |
| InChIKey | XAZBSZKRHOFLGP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|