C22H25O6P — CID 138718891
[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl] bis(4-methoxyphenyl) phosphite (PubChem CID 138718891) has the molecular formula C22H25O6P and a molecular weight of 416.41 g/mol. Its IUPAC name is [(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl] bis(4-methoxyphenyl) phosphite.
| Compound Name | [(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl] bis(4-methoxyphenyl) phosphite |
|---|---|
| PubChem CID | 138718891 |
| Molecular Formula | C22H25O6P |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl] bis(4-methoxyphenyl) phosphite |
| SMILES | C=C/C(=C\C=C(/C)OP(Oc1ccc(OC)cc1)Oc1ccc(OC)cc1)OC |
| InChI | InChI=1S/C22H25O6P/c1-6-18(23-3)8-7-17(2)26-29(27-21-13-9-19(24-4)10-14-21)28-22-15-11-20(25-5)12-16-22/h6-16H,1H2,2-5H3/b17-7+,18-8+ |
| InChIKey | PQCMYACGJLGWKA-ZEELXFFVSA-N |
| XLogP | 6.03 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|