C14H17NO — CID 174328933
(2Z)-N-[(4-methoxyphenyl)methyl]-3-methylpenta-2,4-dien-1-imine (PubChem CID 174328933) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (2Z)-N-[(4-methoxyphenyl)methyl]-3-methylpenta-2,4-dien-1-imine.
| Compound Name | (2Z)-N-[(4-methoxyphenyl)methyl]-3-methylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 174328933 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (2Z)-N-[(4-methoxyphenyl)methyl]-3-methylpenta-2,4-dien-1-imine |
| SMILES | C=C/C(C)=C\C=N\Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H17NO/c1-4-12(2)9-10-15-11-13-5-7-14(16-3)8-6-13/h4-10H,1,11H2,2-3H3/b12-9-,15-10+ |
| InChIKey | YLRLGCCLJVPJOI-LURFLBPHSA-N |
| XLogP | 3.40 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|