C10H13N3O — CID 142987862
N'-[(4-methoxyphenyl)methyl]-N-(methylideneamino)methanimidamide (PubChem CID 142987862) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is N'-[(4-methoxyphenyl)methyl]-N-(methylideneamino)methanimidamide.
| Compound Name | N'-[(4-methoxyphenyl)methyl]-N-(methylideneamino)methanimidamide |
|---|---|
| PubChem CID | 142987862 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N'-[(4-methoxyphenyl)methyl]-N-(methylideneamino)methanimidamide |
| SMILES | C=NN/C=N/Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C10H13N3O/c1-11-13-8-12-7-9-3-5-10(14-2)6-4-9/h3-6,8H,1,7H2,2H3,(H,12,13) |
| InChIKey | FJQKSSICEAGPST-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|