C12H12F3NO2 — CID 146089817
N-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]prop-2-enamide (PubChem CID 146089817) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is N-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 146089817 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccc(OC)cc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO2/c1-3-11(17)16-7-8-4-5-9(18-2)6-10(8)12(13,14)15/h3-6H,1,7H2,2H3,(H,16,17) |
| InChIKey | DSMVWJZGYCSHAP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|