C23H27NO — CID 142487241
(3E,5E)-N-benzhydryl-3-ethenyl-6-methoxyhepta-3,5-dien-2-amine (PubChem CID 142487241) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is (3E,5E)-N-benzhydryl-3-ethenyl-6-methoxyhepta-3,5-dien-2-amine.
| Compound Name | (3E,5E)-N-benzhydryl-3-ethenyl-6-methoxyhepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 142487241 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (3E,5E)-N-benzhydryl-3-ethenyl-6-methoxyhepta-3,5-dien-2-amine |
| SMILES | C=C/C(=C\C=C(/C)OC)C(C)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27NO/c1-5-20(17-16-18(2)25-4)19(3)24-23(21-12-8-6-9-13-21)22-14-10-7-11-15-22/h5-17,19,23-24H,1H2,2-4H3/b18-16+,20-17+ |
| InChIKey | FBTVSYSJTPGTIA-JEEWHQRCSA-N |
| XLogP | 5.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|