C16H21N — CID 170263201
(2R,3E,5Z)-N-benzyl-3-ethenylhepta-3,5-dien-2-amine (PubChem CID 170263201) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (2R,3E,5Z)-N-benzyl-3-ethenylhepta-3,5-dien-2-amine.
| Compound Name | (2R,3E,5Z)-N-benzyl-3-ethenylhepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 170263201 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (2R,3E,5Z)-N-benzyl-3-ethenylhepta-3,5-dien-2-amine |
| SMILES | C=C/C(=C\C=C/C)[C@@H](C)NCc1ccccc1 |
| InChI | InChI=1S/C16H21N/c1-4-6-12-16(5-2)14(3)17-13-15-10-8-7-9-11-15/h4-12,14,17H,2,13H2,1,3H3/b6-4-,16-12+/t14-/m1/s1 |
| InChIKey | JUXSSSCTDGBUMY-NOJPNFPWSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|