C17H20O2 — CID 126727419
(3E,5E,7E,9E)-6,7-bis(ethenyl)-10-methoxydodeca-1,3,5,7,9,11-hexaen-3-ol (PubChem CID 126727419) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is (3E,5E,7E,9E)-6,7-bis(ethenyl)-10-methoxydodeca-1,3,5,7,9,11-hexaen-3-ol.
| Compound Name | (3E,5E,7E,9E)-6,7-bis(ethenyl)-10-methoxydodeca-1,3,5,7,9,11-hexaen-3-ol |
|---|---|
| PubChem CID | 126727419 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (3E,5E,7E,9E)-6,7-bis(ethenyl)-10-methoxydodeca-1,3,5,7,9,11-hexaen-3-ol |
| SMILES | C=C/C(O)=C\C=C(C=C)\C(C=C)=C\C=C(/C=C)OC |
| InChI | InChI=1S/C17H20O2/c1-6-14(10-12-16(18)8-3)15(7-2)11-13-17(9-4)19-5/h6-13,18H,1-4H2,5H3/b14-10+,15-11+,16-12+,17-13+ |
| InChIKey | GQIAXEAFYVPREA-MKELXVRNSA-N |
| XLogP | 4.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|