C33H40O4S — CID 146397585
(3E,5E,7E,9Z)-6-ethenyl-7-ethyl-3-[(3E,5E)-6-[(3E,5E)-6-methoxyocta-1,3,5,7-tetraen-3-yl]sulfonylocta-1,3,5,7-tetraen-3-yl]oxydodeca-1,3,5,7,9-pentaene (PubChem CID 146397585) has the molecular formula C33H40O4S and a molecular weight of 532.75 g/mol. Its IUPAC name is (3E,5E,7E,9Z)-6-ethenyl-7-ethyl-3-[(3E,5E)-6-[(3E,5E)-6-methoxyocta-1,3,5,7-tetraen-3-yl]sulfonylocta-1,3,5,7-tetraen-3-yl]oxydodeca-1,3,5,7,9-pentaene.
| Compound Name | (3E,5E,7E,9Z)-6-ethenyl-7-ethyl-3-[(3E,5E)-6-[(3E,5E)-6-methoxyocta-1,3,5,7-tetraen-3-yl]sulfonylocta-1,3,5,7-tetraen-3-yl]oxydodeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 146397585 |
| Molecular Formula | C33H40O4S |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | (3E,5E,7E,9Z)-6-ethenyl-7-ethyl-3-[(3E,5E)-6-[(3E,5E)-6-methoxyocta-1,3,5,7-tetraen-3-yl]sulfonylocta-1,3,5,7-tetraen-3-yl]oxydodeca-1,3,5,7,9-pentaene |
| SMILES | C=C/C(=C\C=C(/C=C)S(=O)(=O)/C(C=C)=C/C=C(\C=C)O/C(C=C)=C/C=C(C=C)/C(=C/C=C\CC)CC)OC |
| InChI | InChI=1S/C33H40O4S/c1-10-18-19-20-27(11-2)28(12-3)21-22-30(14-5)37-31(15-6)24-26-33(17-8)38(34,35)32(16-7)25-23-29(13-4)36-9/h12-26H,3-8,10-11H2,1-2,9H3/b19-18-,27-20+,28-21+,29-23+,30-22+,31-24+,32-25+,33-26+ |
| InChIKey | OOJOROXJSXNLES-STSNHNOMSA-N |
| XLogP | 8.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|