C6H10OS — CID 178133797
(1E)-2-methoxy-1-methylsulfanylbuta-1,3-diene (PubChem CID 178133797) has the molecular formula C6H10OS and a molecular weight of 130.21 g/mol. Its IUPAC name is (1E)-2-methoxy-1-methylsulfanylbuta-1,3-diene.
| Compound Name | (1E)-2-methoxy-1-methylsulfanylbuta-1,3-diene |
|---|---|
| PubChem CID | 178133797 |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.21 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | (1E)-2-methoxy-1-methylsulfanylbuta-1,3-diene |
| SMILES | C=C/C(=C\SC)OC |
| InChI | InChI=1S/C6H10OS/c1-4-6(7-2)5-8-3/h4-5H,1H2,2-3H3/b6-5+ |
| InChIKey | QZUNASLCWCMOPK-AATRIKPKSA-N |
| XLogP | 2.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|