C7H11NO2 — CID 178170806
N-[(1Z)-2-methoxybuta-1,3-dienyl]acetamide (PubChem CID 178170806) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is N-[(1Z)-2-methoxybuta-1,3-dienyl]acetamide.
| Compound Name | N-[(1Z)-2-methoxybuta-1,3-dienyl]acetamide |
|---|---|
| PubChem CID | 178170806 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | N-[(1Z)-2-methoxybuta-1,3-dienyl]acetamide |
| SMILES | C=C/C(=C/NC(C)=O)OC |
| InChI | InChI=1S/C7H11NO2/c1-4-7(10-3)5-8-6(2)9/h4-5H,1H2,2-3H3,(H,8,9)/b7-5- |
| InChIKey | ISTKDFYTDCIDGQ-ALCCZGGFSA-N |
| XLogP | 0.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|