C5H10N2S — CID 144767038
[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]hydrazine (PubChem CID 144767038) has the molecular formula C5H10N2S and a molecular weight of 130.22 g/mol. Its IUPAC name is [(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]hydrazine.
| Compound Name | [(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]hydrazine |
|---|---|
| PubChem CID | 144767038 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | [(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]hydrazine |
| SMILES | C=C/C(=C\SC)NN |
| InChI | InChI=1S/C5H10N2S/c1-3-5(7-6)4-8-2/h3-4,7H,1,6H2,2H3/b5-4+ |
| InChIKey | YWCGGSIKPAJMKH-SNAWJCMRSA-N |
| XLogP | 0.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|