C6H12N2 — CID 59490935
[(2E,4Z)-hexa-2,4-dien-3-yl]hydrazine (PubChem CID 59490935) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is [(2E,4Z)-hexa-2,4-dien-3-yl]hydrazine.
| Compound Name | [(2E,4Z)-hexa-2,4-dien-3-yl]hydrazine |
|---|---|
| PubChem CID | 59490935 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | [(2E,4Z)-hexa-2,4-dien-3-yl]hydrazine |
| SMILES | C/C=C\C(=C/C)NN |
| InChI | InChI=1S/C6H12N2/c1-3-5-6(4-2)8-7/h3-5,8H,7H2,1-2H3/b5-3-,6-4+ |
| InChIKey | CKGUPRHFRJAWCS-CIIODKQPSA-N |
| XLogP | 0.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|