About carbanide;oxotungsten;phenylhydrazine
carbanide;oxotungsten;phenylhydrazine (PubChem CID 58583063) has the molecular formula C7H10N2OW-2
and a molecular weight of 322.01 g/mol. Its IUPAC name is carbanide;oxotungsten;phenylhydrazine.
Molecular Properties
| Compound Name | carbanide;oxotungsten;phenylhydrazine |
| PubChem CID | 58583063 |
| Molecular Formula | C7H10N2OW-2 |
| Molecular Weight | 322.01 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | carbanide;oxotungsten;phenylhydrazine |
| SMILES | NNc1[c-]cccc1.O=[W].[CH3-] |
| InChI | InChI=1S/C6H7N2.CH3.O.W/c7-8-6-4-2-1-3-5-6;;;/h1-4,8H,7H2;1H3;;/q2*-1;; |
| InChIKey | CTOKFXZIXIFTHT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.01 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbanide;oxotungsten;phenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;oxotungsten;phenylhydrazine?
The IUPAC name of carbanide;oxotungsten;phenylhydrazine (CID 58583063) is carbanide;oxotungsten;phenylhydrazine.
What is the SMILES notation for carbanide;oxotungsten;phenylhydrazine?
The canonical SMILES for carbanide;oxotungsten;phenylhydrazine is NNc1[c-]cccc1.O=[W].[CH3-].
What is the InChIKey of carbanide;oxotungsten;phenylhydrazine?
The InChIKey is CTOKFXZIXIFTHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N2.CH3.O.W/c7-8-6-4-2-1-3-5-6;;;/h1-4,8H,7H2;1H3;;/q2*-1;;.
What are the key properties of carbanide;oxotungsten;phenylhydrazine?
carbanide;oxotungsten;phenylhydrazine has a molecular weight of 322.01 g/mol, XLogP of 1.10, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;oxotungsten;phenylhydrazine is sourced from PubChem (CID 58583063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).