C6H9FN2 — CID 157043314
[(3E)-2-fluorohexa-1,3,5-trien-3-yl]hydrazine (PubChem CID 157043314) has the molecular formula C6H9FN2 and a molecular weight of 128.15 g/mol. Its IUPAC name is [(3E)-2-fluorohexa-1,3,5-trien-3-yl]hydrazine.
| Compound Name | [(3E)-2-fluorohexa-1,3,5-trien-3-yl]hydrazine |
|---|---|
| PubChem CID | 157043314 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | [(3E)-2-fluorohexa-1,3,5-trien-3-yl]hydrazine |
| SMILES | C=C/C=C(/NN)C(=C)F |
| InChI | InChI=1S/C6H9FN2/c1-3-4-6(9-8)5(2)7/h3-4,9H,1-2,8H2/b6-4+ |
| InChIKey | NFDVLQZNPYILBH-GQCTYLIASA-N |
| XLogP | 1.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|