C6H8F2N2 — CID 143782184
[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]hydrazine (PubChem CID 143782184) has the molecular formula C6H8F2N2 and a molecular weight of 146.14 g/mol. Its IUPAC name is [(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]hydrazine.
| Compound Name | [(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]hydrazine |
|---|---|
| PubChem CID | 143782184 |
| Molecular Formula | C6H8F2N2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | [(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]hydrazine |
| SMILES | C=C/C(F)=C(/F)C(=C)NN |
| InChI | InChI=1S/C6H8F2N2/c1-3-5(7)6(8)4(2)10-9/h3,10H,1-2,9H2/b6-5- |
| InChIKey | OKTHNQZQDZHOJO-WAYWQWQTSA-N |
| XLogP | 1.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|