C6H10N2 — CID 142988661
[(3Z)-hexa-1,3,5-trien-2-yl]hydrazine (PubChem CID 142988661) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is [(3Z)-hexa-1,3,5-trien-2-yl]hydrazine.
| Compound Name | [(3Z)-hexa-1,3,5-trien-2-yl]hydrazine |
|---|---|
| PubChem CID | 142988661 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | [(3Z)-hexa-1,3,5-trien-2-yl]hydrazine |
| SMILES | C=C/C=C\C(=C)NN |
| InChI | InChI=1S/C6H10N2/c1-3-4-5-6(2)8-7/h3-5,8H,1-2,7H2/b5-4- |
| InChIKey | PSYMBYCDFYKNQT-PLNGDYQASA-N |
| XLogP | 0.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|