C7H11FN2 — CID 143782158
[(3E)-4-fluoro-3-methylhexa-1,3,5-trien-2-yl]hydrazine (PubChem CID 143782158) has the molecular formula C7H11FN2 and a molecular weight of 142.18 g/mol. Its IUPAC name is [(3E)-4-fluoro-3-methylhexa-1,3,5-trien-2-yl]hydrazine.
| Compound Name | [(3E)-4-fluoro-3-methylhexa-1,3,5-trien-2-yl]hydrazine |
|---|---|
| PubChem CID | 143782158 |
| Molecular Formula | C7H11FN2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | [(3E)-4-fluoro-3-methylhexa-1,3,5-trien-2-yl]hydrazine |
| SMILES | C=C/C(F)=C(/C)C(=C)NN |
| InChI | InChI=1S/C7H11FN2/c1-4-7(8)5(2)6(3)10-9/h4,10H,1,3,9H2,2H3/b7-5+ |
| InChIKey | BJXYQXGTMBCQTJ-FNORWQNLSA-N |
| XLogP | 1.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|