C8H13FN2 — CID 143782177
[(3E,5Z)-3-fluoro-4-methylhepta-1,3,5-trien-2-yl]hydrazine (PubChem CID 143782177) has the molecular formula C8H13FN2 and a molecular weight of 156.20 g/mol. Its IUPAC name is [(3E,5Z)-3-fluoro-4-methylhepta-1,3,5-trien-2-yl]hydrazine.
| Compound Name | [(3E,5Z)-3-fluoro-4-methylhepta-1,3,5-trien-2-yl]hydrazine |
|---|---|
| PubChem CID | 143782177 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | [(3E,5Z)-3-fluoro-4-methylhepta-1,3,5-trien-2-yl]hydrazine |
| SMILES | C=C(NN)/C(F)=C(C)\C=C/C |
| InChI | InChI=1S/C8H13FN2/c1-4-5-6(2)8(9)7(3)11-10/h4-5,11H,3,10H2,1-2H3/b5-4-,8-6+ |
| InChIKey | XPPPBESBHAAERH-GSGSLZOQSA-N |
| XLogP | 1.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|