C11H19F3N2 — CID 143772148
ethane;[(2E,4E)-6-methyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-yl]hydrazine (PubChem CID 143772148) has the molecular formula C11H19F3N2 and a molecular weight of 236.28 g/mol. Its IUPAC name is ethane;[(2E,4E)-6-methyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-yl]hydrazine.
| Compound Name | ethane;[(2E,4E)-6-methyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-yl]hydrazine |
|---|---|
| PubChem CID | 143772148 |
| Molecular Formula | C11H19F3N2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | ethane;[(2E,4E)-6-methyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-yl]hydrazine |
| SMILES | C=C(C)/C=C(\C=C(/C)NN)C(F)(F)F.CC |
| InChI | InChI=1S/C9H13F3N2.C2H6/c1-6(2)4-8(9(10,11)12)5-7(3)14-13;1-2/h4-5,14H,1,13H2,2-3H3;1-2H3/b7-5+,8-4+; |
| InChIKey | MANZRGAYRPJZAV-VDQZQDHGSA-N |
| XLogP | 3.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|