C8H11FN2 — CID 143119737
(6-fluoro-2-methylcyclohepta-1,4,6-trien-1-yl)hydrazine (PubChem CID 143119737) has the molecular formula C8H11FN2 and a molecular weight of 154.19 g/mol. Its IUPAC name is (6-fluoro-2-methylcyclohepta-1,4,6-trien-1-yl)hydrazine.
| Compound Name | (6-fluoro-2-methylcyclohepta-1,4,6-trien-1-yl)hydrazine |
|---|---|
| PubChem CID | 143119737 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | (6-fluoro-2-methylcyclohepta-1,4,6-trien-1-yl)hydrazine |
| SMILES | CC1=C(NN)C=C(F)C=CC1 |
| InChI | InChI=1S/C8H11FN2/c1-6-3-2-4-7(9)5-8(6)11-10/h2,4-5,11H,3,10H2,1H3 |
| InChIKey | GZUBPNJVQNFMQR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|