C8H13FN2 — CID 177039274
3-fluoro-6-methyl-4-propan-2-yl-1,2-dihydropyridazine (PubChem CID 177039274) has the molecular formula C8H13FN2 and a molecular weight of 156.20 g/mol. Its IUPAC name is 3-fluoro-6-methyl-4-propan-2-yl-1,2-dihydropyridazine.
| Compound Name | 3-fluoro-6-methyl-4-propan-2-yl-1,2-dihydropyridazine |
|---|---|
| PubChem CID | 177039274 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | 3-fluoro-6-methyl-4-propan-2-yl-1,2-dihydropyridazine |
| SMILES | CC1=CC(C(C)C)=C(F)NN1 |
| InChI | InChI=1S/C8H13FN2/c1-5(2)7-4-6(3)10-11-8(7)9/h4-5,10-11H,1-3H3 |
| InChIKey | YTQPCWQGJKPUKC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|