C9H13F3N2 — CID 143772149
[(2E,4E)-6-methyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-yl]hydrazine (PubChem CID 143772149) has the molecular formula C9H13F3N2 and a molecular weight of 206.21 g/mol. Its IUPAC name is [(2E,4E)-6-methyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-yl]hydrazine.
| Compound Name | [(2E,4E)-6-methyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-yl]hydrazine |
|---|---|
| PubChem CID | 143772149 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | [(2E,4E)-6-methyl-4-(trifluoromethyl)hepta-2,4,6-trien-2-yl]hydrazine |
| SMILES | C=C(C)/C=C(\C=C(/C)NN)C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2/c1-6(2)4-8(9(10,11)12)5-7(3)14-13/h4-5,14H,1,13H2,2-3H3/b7-5+,8-4+ |
| InChIKey | DKCNCJZZDPWRMW-JBVHCYJISA-N |
| XLogP | 2.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|