C7H10ClFN2 — CID 154687888
[(2E,4E)-4-chloro-6-fluorohepta-2,4,6-trien-3-yl]hydrazine (PubChem CID 154687888) has the molecular formula C7H10ClFN2 and a molecular weight of 176.62 g/mol. Its IUPAC name is [(2E,4E)-4-chloro-6-fluorohepta-2,4,6-trien-3-yl]hydrazine.
| Compound Name | [(2E,4E)-4-chloro-6-fluorohepta-2,4,6-trien-3-yl]hydrazine |
|---|---|
| PubChem CID | 154687888 |
| Molecular Formula | C7H10ClFN2 |
| Molecular Weight | 176.62 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | [(2E,4E)-4-chloro-6-fluorohepta-2,4,6-trien-3-yl]hydrazine |
| SMILES | C=C(F)/C=C(Cl)\C(=C/C)NN |
| InChI | InChI=1S/C7H10ClFN2/c1-3-7(11-10)6(8)4-5(2)9/h3-4,11H,2,10H2,1H3/b6-4+,7-3- |
| InChIKey | FXFIKWWLHXBZHC-KUSYPTLRSA-N |
| XLogP | 1.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.62 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|