C5H7ClN2 — CID 89001113
3-chloro-6-methyl-1,2-dihydropyridazine (PubChem CID 89001113) has the molecular formula C5H7ClN2 and a molecular weight of 130.58 g/mol. Its IUPAC name is 3-chloro-6-methyl-1,2-dihydropyridazine.
| Compound Name | 3-chloro-6-methyl-1,2-dihydropyridazine |
|---|---|
| PubChem CID | 89001113 |
| Molecular Formula | C5H7ClN2 |
| Molecular Weight | 130.58 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 3-chloro-6-methyl-1,2-dihydropyridazine |
| SMILES | CC1=CC=C(Cl)NN1 |
| InChI | InChI=1S/C5H7ClN2/c1-4-2-3-5(6)8-7-4/h2-3,7-8H,1H3 |
| InChIKey | QOODTOLTZIJITD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.58 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|