C7H11ClN2 — CID 142912551
[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]hydrazine (PubChem CID 142912551) has the molecular formula C7H11ClN2 and a molecular weight of 158.63 g/mol. Its IUPAC name is [(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]hydrazine.
| Compound Name | [(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]hydrazine |
|---|---|
| PubChem CID | 142912551 |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | [(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]hydrazine |
| SMILES | C=C/C(=C\C=C(/C)Cl)NN |
| InChI | InChI=1S/C7H11ClN2/c1-3-7(10-9)5-4-6(2)8/h3-5,10H,1,9H2,2H3/b6-4+,7-5+ |
| InChIKey | HYPQZVWAPIDEHN-YDFGWWAZSA-N |
| XLogP | 1.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|