C5H9ClN2 — CID 145075833
[(2E)-4-chloropenta-2,4-dien-2-yl]hydrazine (PubChem CID 145075833) has the molecular formula C5H9ClN2 and a molecular weight of 132.59 g/mol. Its IUPAC name is [(2E)-4-chloropenta-2,4-dien-2-yl]hydrazine.
| Compound Name | [(2E)-4-chloropenta-2,4-dien-2-yl]hydrazine |
|---|---|
| PubChem CID | 145075833 |
| Molecular Formula | C5H9ClN2 |
| Molecular Weight | 132.59 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | [(2E)-4-chloropenta-2,4-dien-2-yl]hydrazine |
| SMILES | C=C(Cl)/C=C(\C)NN |
| InChI | InChI=1S/C5H9ClN2/c1-4(6)3-5(2)8-7/h3,8H,1,7H2,2H3/b5-3+ |
| InChIKey | QYYWPUGCSYXJDG-HWKANZROSA-N |
| XLogP | 1.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.59 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|