About (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine
(1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine (PubChem CID 170047480) has the molecular formula C10H21N3O2S
and a molecular weight of 247.36 g/mol. Its IUPAC name is (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine |
| PubChem CID | 170047480 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine |
| SMILES | C=C/C(=C(/NN)N(C)C(C)C)S(=O)(=O)CC |
| InChI | InChI=1S/C10H21N3O2S/c1-6-9(16(14,15)7-2)10(12-11)13(5)8(3)4/h6,8,12H,1,7,11H2,2-5H3/b10-9+ |
| InChIKey | ISJXVRBKRYKGFG-MDZDMXLPSA-N |
| XLogP | 0.58 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine?
The IUPAC name of (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine (CID 170047480) is (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine.
What is the SMILES notation for (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine?
The canonical SMILES for (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine is C=C/C(=C(/NN)N(C)C(C)C)S(=O)(=O)CC.
What is the InChIKey of (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine?
The InChIKey is ISJXVRBKRYKGFG-MDZDMXLPSA-N. The full InChI is InChI=1S/C10H21N3O2S/c1-6-9(16(14,15)7-2)10(12-11)13(5)8(3)4/h6,8,12H,1,7,11H2,2-5H3/b10-9+.
What are the key properties of (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine?
(1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine has a molecular weight of 247.36 g/mol, XLogP of 0.58, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-2-ethylsulfonyl-1-hydrazinyl-N-methyl-N-propan-2-ylbuta-1,3-dien-1-amine is sourced from PubChem (CID 170047480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).