C8H13BO3 — CID 143927143
[(2Z,4E)-5-methoxyhepta-2,4,6-trien-3-yl]boronic acid (PubChem CID 143927143) has the molecular formula C8H13BO3 and a molecular weight of 168.00 g/mol. Its IUPAC name is [(2Z,4E)-5-methoxyhepta-2,4,6-trien-3-yl]boronic acid.
| Compound Name | [(2Z,4E)-5-methoxyhepta-2,4,6-trien-3-yl]boronic acid |
|---|---|
| PubChem CID | 143927143 |
| Molecular Formula | C8H13BO3 |
| Molecular Weight | 168.00 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | [(2Z,4E)-5-methoxyhepta-2,4,6-trien-3-yl]boronic acid |
| SMILES | C=C/C(=C\C(=C/C)B(O)O)OC |
| InChI | InChI=1S/C8H13BO3/c1-4-7(9(10)11)6-8(5-2)12-3/h4-6,10-11H,2H2,1,3H3/b7-4+,8-6+ |
| InChIKey | BQVHZHOKDFWEMM-IJYBVRAASA-N |
| XLogP | 0.66 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.00 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|