[(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid

C7H11BO3 — CID 155579248

IUPAC[(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid
SMILESC=C/C(OC)=C(\C=C)B(O)O
InChIInChI=1S/C7H11BO3/c1-4-6(8(9)10)7(5-2)11-3/h4-5,9-10H,1-2H2,3H3/b7-6-
InChIKeyNKRVGSPCPBHAEX-SREVYHEPSA-N
MW153.97 g/mol
LogP0.27
Rot. Bonds4

About [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid

[(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid (PubChem CID 155579248) has the molecular formula C7H11BO3 and a molecular weight of 153.97 g/mol. Its IUPAC name is [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid.

Molecular Properties

Compound Name[(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid
PubChem CID155579248
Molecular FormulaC7H11BO3
Molecular Weight153.97 g/mol
Exact Mass154.08
IUPAC Name[(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid
SMILESC=C/C(OC)=C(\C=C)B(O)O
InChIInChI=1S/C7H11BO3/c1-4-6(8(9)10)7(5-2)11-3/h4-5,9-10H,1-2H2,3H3/b7-6-
InChIKeyNKRVGSPCPBHAEX-SREVYHEPSA-N
XLogP0.27
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.97
LogP ≤ 50.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid?
The IUPAC name of [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid (CID 155579248) is [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid.
What is the SMILES notation for [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid?
The canonical SMILES for [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid is C=C/C(OC)=C(\C=C)B(O)O.
What is the InChIKey of [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid?
The InChIKey is NKRVGSPCPBHAEX-SREVYHEPSA-N. The full InChI is InChI=1S/C7H11BO3/c1-4-6(8(9)10)7(5-2)11-3/h4-5,9-10H,1-2H2,3H3/b7-6-.
What are the key properties of [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid?
[(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid has a molecular weight of 153.97 g/mol, XLogP of 0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid is sourced from PubChem (CID 155579248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).