C7H11BO3 — CID 155579248
[(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid (PubChem CID 155579248) has the molecular formula C7H11BO3 and a molecular weight of 153.97 g/mol. Its IUPAC name is [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid.
| Compound Name | [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid |
|---|---|
| PubChem CID | 155579248 |
| Molecular Formula | C7H11BO3 |
| Molecular Weight | 153.97 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | [(3E)-4-methoxyhexa-1,3,5-trien-3-yl]boronic acid |
| SMILES | C=C/C(OC)=C(\C=C)B(O)O |
| InChI | InChI=1S/C7H11BO3/c1-4-6(8(9)10)7(5-2)11-3/h4-5,9-10H,1-2H2,3H3/b7-6- |
| InChIKey | NKRVGSPCPBHAEX-SREVYHEPSA-N |
| XLogP | 0.27 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.97 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|