C11H19NO — CID 88960998
(3Z,5E)-3-methoxy-7,7-dimethylocta-1,3,5-trien-4-amine (PubChem CID 88960998) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (3Z,5E)-3-methoxy-7,7-dimethylocta-1,3,5-trien-4-amine.
| Compound Name | (3Z,5E)-3-methoxy-7,7-dimethylocta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 88960998 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (3Z,5E)-3-methoxy-7,7-dimethylocta-1,3,5-trien-4-amine |
| SMILES | C=C/C(OC)=C(N)\C=C\C(C)(C)C |
| InChI | InChI=1S/C11H19NO/c1-6-10(13-5)9(12)7-8-11(2,3)4/h6-8H,1,12H2,2-5H3/b8-7+,10-9- |
| InChIKey | ORYZOTKZPVAVNC-GOJKSUSPSA-N |
| XLogP | 2.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|