C8H14N2O — CID 176556848
O-[(3Z)-4-amino-6-methylhepta-1,3,5-trien-3-yl]hydroxylamine (PubChem CID 176556848) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is O-[(3Z)-4-amino-6-methylhepta-1,3,5-trien-3-yl]hydroxylamine.
| Compound Name | O-[(3Z)-4-amino-6-methylhepta-1,3,5-trien-3-yl]hydroxylamine |
|---|---|
| PubChem CID | 176556848 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | O-[(3Z)-4-amino-6-methylhepta-1,3,5-trien-3-yl]hydroxylamine |
| SMILES | C=C/C(ON)=C(/N)C=C(C)C |
| InChI | InChI=1S/C8H14N2O/c1-4-8(11-10)7(9)5-6(2)3/h4-5H,1,9-10H2,2-3H3/b8-7- |
| InChIKey | BNLXTYOSISJLEZ-FPLPWBNLSA-N |
| XLogP | 1.20 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|