About 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine
5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine (PubChem CID 126636597) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine.
Molecular Properties
| Compound Name | 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine |
| PubChem CID | 126636597 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine |
| SMILES | C=C(N)C(C=C(C)C)=C(C)C |
| InChI | InChI=1S/C10H17N/c1-7(2)6-10(8(3)4)9(5)11/h6H,5,11H2,1-4H3 |
| InChIKey | XEOTWAXWVOCWHJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine?
The IUPAC name of 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine (CID 126636597) is 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine.
What is the SMILES notation for 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine?
The canonical SMILES for 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine is C=C(N)C(C=C(C)C)=C(C)C.
What is the InChIKey of 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine?
The InChIKey is XEOTWAXWVOCWHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-7(2)6-10(8(3)4)9(5)11/h6H,5,11H2,1-4H3.
What are the key properties of 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine?
5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine has a molecular weight of 151.25 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-propan-2-ylidenehexa-1,4-dien-2-amine is sourced from PubChem (CID 126636597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).