C15H24O4 — CID 88560437
2-(2-ethenoxyethoxy)ethyl 4-methyl-2-propan-2-ylidenepent-3-enoate (PubChem CID 88560437) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-(2-ethenoxyethoxy)ethyl 4-methyl-2-propan-2-ylidenepent-3-enoate.
| Compound Name | 2-(2-ethenoxyethoxy)ethyl 4-methyl-2-propan-2-ylidenepent-3-enoate |
|---|---|
| PubChem CID | 88560437 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-(2-ethenoxyethoxy)ethyl 4-methyl-2-propan-2-ylidenepent-3-enoate |
| SMILES | C=COCCOCCOC(=O)C(C=C(C)C)=C(C)C |
| InChI | InChI=1S/C15H24O4/c1-6-17-7-8-18-9-10-19-15(16)14(13(4)5)11-12(2)3/h6,11H,1,7-10H2,2-5H3 |
| InChIKey | RTISMDCDLNCHDM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|