C15H26O2 — CID 89361428
hexyl 4-methyl-2-propan-2-ylidenepent-3-enoate (PubChem CID 89361428) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is hexyl 4-methyl-2-propan-2-ylidenepent-3-enoate.
| Compound Name | hexyl 4-methyl-2-propan-2-ylidenepent-3-enoate |
|---|---|
| PubChem CID | 89361428 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | hexyl 4-methyl-2-propan-2-ylidenepent-3-enoate |
| SMILES | CCCCCCOC(=O)C(C=C(C)C)=C(C)C |
| InChI | InChI=1S/C15H26O2/c1-6-7-8-9-10-17-15(16)14(13(4)5)11-12(2)3/h11H,6-10H2,1-5H3 |
| InChIKey | SOZUJOYATRAJQB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|