C6H9NO2 — CID 91521118
5-amino-4-hydroxyhexa-3,5-dien-2-one (PubChem CID 91521118) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 5-amino-4-hydroxyhexa-3,5-dien-2-one.
| Compound Name | 5-amino-4-hydroxyhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 91521118 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 5-amino-4-hydroxyhexa-3,5-dien-2-one |
| SMILES | C=C(N)C(O)=CC(C)=O |
| InChI | InChI=1S/C6H9NO2/c1-4(8)3-6(9)5(2)7/h3,9H,2,7H2,1H3 |
| InChIKey | HUJGKEMUTOVRRT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|