C6H8O3 — CID 74058878
3-hydroxyhex-3-ene-2,5-dione (PubChem CID 74058878) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is 3-hydroxyhex-3-ene-2,5-dione.
| Compound Name | 3-hydroxyhex-3-ene-2,5-dione |
|---|---|
| PubChem CID | 74058878 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 3-hydroxyhex-3-ene-2,5-dione |
| SMILES | CC(=O)C=C(O)C(C)=O |
| InChI | InChI=1S/C6H8O3/c1-4(7)3-6(9)5(2)8/h3,9H,1-2H3 |
| InChIKey | LRAVRYAYMRSFDZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|