C9H14N2O2 — CID 162411558
methyl (E)-2-diazo-5,5-dimethylhex-3-enoate (PubChem CID 162411558) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is methyl (E)-2-diazo-5,5-dimethylhex-3-enoate.
| Compound Name | methyl (E)-2-diazo-5,5-dimethylhex-3-enoate |
|---|---|
| PubChem CID | 162411558 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | methyl (E)-2-diazo-5,5-dimethylhex-3-enoate |
| SMILES | COC(=O)C(/C=C/C(C)(C)C)=[N+]=[N-] |
| InChI | InChI=1S/C9H14N2O2/c1-9(2,3)6-5-7(11-10)8(12)13-4/h5-6H,1-4H3/b6-5+ |
| InChIKey | IWKDUOWMTJDEIX-AATRIKPKSA-N |
| XLogP | 1.43 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|