C20H28N2O2 — CID 155301792
(E)-N-[4-[[(E)-4,4-dimethylpent-2-enoyl]amino]phenyl]-4,4-dimethylpent-2-enamide (PubChem CID 155301792) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (E)-N-[4-[[(E)-4,4-dimethylpent-2-enoyl]amino]phenyl]-4,4-dimethylpent-2-enamide.
| Compound Name | (E)-N-[4-[[(E)-4,4-dimethylpent-2-enoyl]amino]phenyl]-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 155301792 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (E)-N-[4-[[(E)-4,4-dimethylpent-2-enoyl]amino]phenyl]-4,4-dimethylpent-2-enamide |
| SMILES | CC(C)(C)/C=C/C(=O)Nc1ccc(NC(=O)/C=C/C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H28N2O2/c1-19(2,3)13-11-17(23)21-15-7-9-16(10-8-15)22-18(24)12-14-20(4,5)6/h7-14H,1-6H3,(H,21,23)(H,22,24)/b13-11+,14-12+ |
| InChIKey | BFTMWGDNEIKJAO-PHEQNACWSA-N |
| XLogP | 4.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|