C16H23NO2 — CID 86950140
(E)-N-(4-ethoxy-3-methylphenyl)-4,4-dimethylpent-2-enamide (PubChem CID 86950140) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (E)-N-(4-ethoxy-3-methylphenyl)-4,4-dimethylpent-2-enamide.
| Compound Name | (E)-N-(4-ethoxy-3-methylphenyl)-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 86950140 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (E)-N-(4-ethoxy-3-methylphenyl)-4,4-dimethylpent-2-enamide |
| SMILES | CCOc1ccc(NC(=O)/C=C/C(C)(C)C)cc1C |
| InChI | InChI=1S/C16H23NO2/c1-6-19-14-8-7-13(11-12(14)2)17-15(18)9-10-16(3,4)5/h7-11H,6H2,1-5H3,(H,17,18)/b10-9+ |
| InChIKey | ZAOKXIUUHFYZCF-MDZDMXLPSA-N |
| XLogP | 3.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|