C15H21NO — CID 101271751
(E)-N-(2,4-dimethylphenyl)-4,4-dimethylpent-2-enamide (PubChem CID 101271751) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (E)-N-(2,4-dimethylphenyl)-4,4-dimethylpent-2-enamide.
| Compound Name | (E)-N-(2,4-dimethylphenyl)-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 101271751 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (E)-N-(2,4-dimethylphenyl)-4,4-dimethylpent-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C=C/C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C15H21NO/c1-11-6-7-13(12(2)10-11)16-14(17)8-9-15(3,4)5/h6-10H,1-5H3,(H,16,17)/b9-8+ |
| InChIKey | PILFASGYLSQCIB-CMDGGOBGSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|