C14H26O — CID 145360237
ethane;(3E)-4-ethenyl-3-methoxy-7-methylocta-1,3-diene (PubChem CID 145360237) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is ethane;(3E)-4-ethenyl-3-methoxy-7-methylocta-1,3-diene.
| Compound Name | ethane;(3E)-4-ethenyl-3-methoxy-7-methylocta-1,3-diene |
|---|---|
| PubChem CID | 145360237 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | ethane;(3E)-4-ethenyl-3-methoxy-7-methylocta-1,3-diene |
| SMILES | C=C/C(CCC(C)C)=C(\C=C)OC.CC |
| InChI | InChI=1S/C12H20O.C2H6/c1-6-11(9-8-10(3)4)12(7-2)13-5;1-2/h6-7,10H,1-2,8-9H2,3-5H3;1-2H3/b12-11-; |
| InChIKey | ZDECCJMDJACVFX-AFEZEDKISA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|