C10H18N2O — CID 166807640
butan-2-yl-[(2Z)-3-methoxypenta-2,4-dien-2-yl]diazene (PubChem CID 166807640) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is butan-2-yl-[(2Z)-3-methoxypenta-2,4-dien-2-yl]diazene.
| Compound Name | butan-2-yl-[(2Z)-3-methoxypenta-2,4-dien-2-yl]diazene |
|---|---|
| PubChem CID | 166807640 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | butan-2-yl-[(2Z)-3-methoxypenta-2,4-dien-2-yl]diazene |
| SMILES | C=C/C(OC)=C(C)/N=N/C(C)CC |
| InChI | InChI=1S/C10H18N2O/c1-6-8(3)11-12-9(4)10(7-2)13-5/h7-8H,2,6H2,1,3-5H3/b10-9-,12-11+ |
| InChIKey | ZOEHPHQPUFDQSW-XAZJVICWSA-N |
| XLogP | 3.30 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|