C10H17N — CID 144693544
(4Z)-N-butan-2-ylhexa-1,4-dien-3-imine (PubChem CID 144693544) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (4Z)-N-butan-2-ylhexa-1,4-dien-3-imine.
| Compound Name | (4Z)-N-butan-2-ylhexa-1,4-dien-3-imine |
|---|---|
| PubChem CID | 144693544 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (4Z)-N-butan-2-ylhexa-1,4-dien-3-imine |
| SMILES | C=CC(/C=C\C)=N\C(C)CC |
| InChI | InChI=1S/C10H17N/c1-5-8-10(7-3)11-9(4)6-2/h5,7-9H,3,6H2,1-2,4H3/b8-5-,11-10+ |
| InChIKey | GXHSFDITGJJESA-VPDIDQSWSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|