About 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea
1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea (PubChem CID 123564108) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea.
Molecular Properties
| Compound Name | 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea |
| PubChem CID | 123564108 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea |
| SMILES | C=CC(/C=C\C)=NC(=O)NCC |
| InChI | InChI=1S/C9H14N2O/c1-4-7-8(5-2)11-9(12)10-6-3/h4-5,7H,2,6H2,1,3H3,(H,10,12)/b7-4-,11-8? |
| InChIKey | YMHIUHBJFFDIFK-URBZRCENSA-N |
| XLogP | 1.92 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea?
The IUPAC name of 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea (CID 123564108) is 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea.
What is the SMILES notation for 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea?
The canonical SMILES for 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea is C=CC(/C=C\C)=NC(=O)NCC.
What is the InChIKey of 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea?
The InChIKey is YMHIUHBJFFDIFK-URBZRCENSA-N. The full InChI is InChI=1S/C9H14N2O/c1-4-7-8(5-2)11-9(12)10-6-3/h4-5,7H,2,6H2,1,3H3,(H,10,12)/b7-4-,11-8?.
What are the key properties of 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea?
1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea has a molecular weight of 166.22 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea is sourced from PubChem (CID 123564108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).