C9H14N2O — CID 123564108
1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea (PubChem CID 123564108) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea.
| Compound Name | 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea |
|---|---|
| PubChem CID | 123564108 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-ethyl-3-[(4Z)-hexa-1,4-dien-3-ylidene]urea |
| SMILES | C=CC(/C=C\C)=NC(=O)NCC |
| InChI | InChI=1S/C9H14N2O/c1-4-7-8(5-2)11-9(12)10-6-3/h4-5,7H,2,6H2,1,3H3,(H,10,12)/b7-4-,11-8? |
| InChIKey | YMHIUHBJFFDIFK-URBZRCENSA-N |
| XLogP | 1.92 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|