C17H32F2 — CID 145471831
(3E,5Z)-4-butan-2-yl-3-(1,1-difluoroethyl)hepta-1,3,5-triene;ethane (PubChem CID 145471831) has the molecular formula C17H32F2 and a molecular weight of 274.44 g/mol. Its IUPAC name is (3E,5Z)-4-butan-2-yl-3-(1,1-difluoroethyl)hepta-1,3,5-triene;ethane.
| Compound Name | (3E,5Z)-4-butan-2-yl-3-(1,1-difluoroethyl)hepta-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 145471831 |
| Molecular Formula | C17H32F2 |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.25 |
| IUPAC Name | (3E,5Z)-4-butan-2-yl-3-(1,1-difluoroethyl)hepta-1,3,5-triene;ethane |
| SMILES | C=C/C(=C(\C=C/C)C(C)CC)C(C)(F)F.CC.CC |
| InChI | InChI=1S/C13H20F2.2C2H6/c1-6-9-11(10(4)7-2)12(8-3)13(5,14)15;2*1-2/h6,8-10H,3,7H2,1-2,4-5H3;2*1-2H3/b9-6-,12-11-;; |
| InChIKey | HGNGIUVWWNYHEN-JKHAOOCNSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|