C23H42 — CID 144619694
ethene;3-methyl-6-[(3Z,5Z)-3-methylhepta-1,3,5-trien-4-yl]dodecane (PubChem CID 144619694) has the molecular formula C23H42 and a molecular weight of 318.59 g/mol. Its IUPAC name is ethene;3-methyl-6-[(3Z,5Z)-3-methylhepta-1,3,5-trien-4-yl]dodecane.
| Compound Name | ethene;3-methyl-6-[(3Z,5Z)-3-methylhepta-1,3,5-trien-4-yl]dodecane |
|---|---|
| PubChem CID | 144619694 |
| Molecular Formula | C23H42 |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 318.33 |
| IUPAC Name | ethene;3-methyl-6-[(3Z,5Z)-3-methylhepta-1,3,5-trien-4-yl]dodecane |
| SMILES | C=C.C=C/C(C)=C(\C=C/C)C(CCCCCC)CCC(C)CC |
| InChI | InChI=1S/C21H38.C2H4/c1-7-11-12-13-15-20(17-16-18(5)9-3)21(14-8-2)19(6)10-4;1-2/h8,10,14,18,20H,4,7,9,11-13,15-17H2,1-3,5-6H3;1-2H2/b14-8-,21-19+; |
| InChIKey | CAHZPKUWKCDWOZ-HNHIDZJMSA-N |
| XLogP | 8.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|